C29H19F3N4OS — CID 2320151
1-phenyl-3-thiophen-2-yl-N-[2-[3-(trifluoromethyl)phenyl]-3H-isoindol-1-ylidene]pyrazole-4-carboxamide (PubChem CID 2320151) has the molecular formula C29H19F3N4OS and a molecular weight of 528.56 g/mol. Its IUPAC name is 1-phenyl-3-thiophen-2-yl-N-[2-[3-(trifluoromethyl)phenyl]-3H-isoindol-1-ylidene]pyrazole-4-carboxamide.
| Compound Name | 1-phenyl-3-thiophen-2-yl-N-[2-[3-(trifluoromethyl)phenyl]-3H-isoindol-1-ylidene]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2320151 |
| Molecular Formula | C29H19F3N4OS |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-phenyl-3-thiophen-2-yl-N-[2-[3-(trifluoromethyl)phenyl]-3H-isoindol-1-ylidene]pyrazole-4-carboxamide |
| SMILES | O=C(/N=C1\c2ccccc2CN1c1cccc(C(F)(F)F)c1)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C29H19F3N4OS/c30-29(31,32)20-9-6-12-22(16-20)35-17-19-8-4-5-13-23(19)27(35)33-28(37)24-18-36(21-10-2-1-3-11-21)34-26(24)25-14-7-15-38-25/h1-16,18H,17H2/b33-27+ |
| InChIKey | BPAACEVNNHFYAM-MUGXBBEHSA-N |
| XLogP | 7.23 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|