C18H22FN3O2 — CID 111232439
1-ethyl-3-[(4-fluorophenyl)methyl]-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine (PubChem CID 111232439) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-ethyl-3-[(4-fluorophenyl)methyl]-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(4-fluorophenyl)methyl]-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111232439 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-ethyl-3-[(4-fluorophenyl)methyl]-2-[(3-hydroxy-4-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(O)c1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O2/c1-3-20-18(21-11-13-4-7-15(19)8-5-13)22-12-14-6-9-17(24-2)16(23)10-14/h4-10,23H,3,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | ZUOVVNRQUKJWHD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|