C14H24IN5O3 — CID 111236106
1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111236106) has the molecular formula C14H24IN5O3 and a molecular weight of 437.28 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111236106 |
| Molecular Formula | C14H24IN5O3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccccc1[N+](=O)[O-])NC(C)COC.I |
| InChI | InChI=1S/C14H23N5O3.HI/c1-11(10-22-3)18-14(15-2)17-9-8-16-12-6-4-5-7-13(12)19(20)21;/h4-7,11,16H,8-10H2,1-3H3,(H2,15,17,18);1H |
| InChIKey | OKCCNJMRCMQWBD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|