C15H23N5OS — CID 111234587
1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine (PubChem CID 111234587) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111234587 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
| SMILES | C/N=C(/NCCNc1nc2ccccc2s1)NC(C)COC |
| InChI | InChI=1S/C15H23N5OS/c1-11(10-21-3)19-14(16-2)17-8-9-18-15-20-12-6-4-5-7-13(12)22-15/h4-7,11H,8-10H2,1-3H3,(H,18,20)(H2,16,17,19) |
| InChIKey | CPRQYAGEJVCQKW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|