C16H25N5S2 — CID 111611310
1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111611310) has the molecular formula C16H25N5S2 and a molecular weight of 351.55 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111611310 |
| Molecular Formula | C16H25N5S2 |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCCNc1nc2ccccc2s1)NCC(C)(C)SC |
| InChI | InChI=1S/C16H25N5S2/c1-16(2,22-4)11-20-14(17-3)18-9-10-19-15-21-12-7-5-6-8-13(12)23-15/h5-8H,9-11H2,1-4H3,(H,19,21)(H2,17,18,20) |
| InChIKey | DQBXLAKLFVNPOO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|