C19H24IN5OS — CID 111182703
1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111182703) has the molecular formula C19H24IN5OS and a molecular weight of 497.41 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111182703 |
| Molecular Formula | C19H24IN5OS |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1nc2ccccc2s1)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C19H23N5OS.HI/c1-20-18(23-13-14-7-9-15(25-2)10-8-14)21-11-12-22-19-24-16-5-3-4-6-17(16)26-19;/h3-10H,11-13H2,1-2H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | FRKGFRWRYHZKOJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|