C17H25IN4OS — CID 111762100
1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111762100) has the molecular formula C17H25IN4OS and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111762100 |
| Molecular Formula | C17H25IN4OS |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1sc(C)nc1C)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C17H24N4OS.HI/c1-12-16(23-13(2)21-12)9-10-19-17(18-3)20-11-14-5-7-15(22-4)8-6-14;/h5-8H,9-11H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | QARPPXLDOXDWHO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|