C32H34NO3P — CID 11124080
N-(2-diphenylphosphoryl-3-hydroxy-4,4-dimethyl-1-phenylpentyl)benzamide (PubChem CID 11124080) has the molecular formula C32H34NO3P and a molecular weight of 511.60 g/mol. Its IUPAC name is N-(2-diphenylphosphoryl-3-hydroxy-4,4-dimethyl-1-phenylpentyl)benzamide.
| Compound Name | N-(2-diphenylphosphoryl-3-hydroxy-4,4-dimethyl-1-phenylpentyl)benzamide |
|---|---|
| PubChem CID | 11124080 |
| Molecular Formula | C32H34NO3P |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-(2-diphenylphosphoryl-3-hydroxy-4,4-dimethyl-1-phenylpentyl)benzamide |
| SMILES | CC(C)(C)C(O)C(C(NC(=O)c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34NO3P/c1-32(2,3)30(34)29(37(36,26-20-12-6-13-21-26)27-22-14-7-15-23-27)28(24-16-8-4-9-17-24)33-31(35)25-18-10-5-11-19-25/h4-23,28-30,34H,1-3H3,(H,33,35) |
| InChIKey | QJNUCJGFYCVVDN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|