C23H31IN4O2S — CID 111241542
3-[3-(1,3-benzothiazol-2-yl)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111241542) has the molecular formula C23H31IN4O2S and a molecular weight of 554.50 g/mol. Its IUPAC name is 3-[3-(1,3-benzothiazol-2-yl)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[3-(1,3-benzothiazol-2-yl)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111241542 |
| Molecular Formula | C23H31IN4O2S |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 3-[3-(1,3-benzothiazol-2-yl)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C23H30N4O2S.HI/c1-24-23(25-14-7-10-22-26-18-8-5-6-9-21(18)30-22)27(2)15-13-17-11-12-19(28-3)20(16-17)29-4;/h5-6,8-9,11-12,16H,7,10,13-15H2,1-4H3,(H,24,25);1H |
| InChIKey | HDRYJHYNOMIIQT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|