C21H26N4OS — CID 111339041
1-[3-(1,3-benzothiazol-2-yl)propyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111339041) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111339041 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-[2-(2-methoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)NCCc1ccccc1OC |
| InChI | InChI=1S/C21H26N4OS/c1-22-21(24-15-13-16-8-3-5-10-18(16)26-2)23-14-7-12-20-25-17-9-4-6-11-19(17)27-20/h3-6,8-11H,7,12-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | WOCGDHSKROCNDF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|