C15H23IN4OS — CID 110941131
1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 110941131) has the molecular formula C15H23IN4OS and a molecular weight of 434.35 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110941131 |
| Molecular Formula | C15H23IN4OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)NCCOC.I |
| InChI | InChI=1S/C15H22N4OS.HI/c1-16-15(18-10-11-20-2)17-9-5-8-14-19-12-6-3-4-7-13(12)21-14;/h3-4,6-7H,5,8-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | ZUSIPHMMPUEYHI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|