C18H22IN5S — CID 110969611
1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110969611) has the molecular formula C18H22IN5S and a molecular weight of 467.38 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110969611 |
| Molecular Formula | C18H22IN5S |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)NCc1ccccn1.I |
| InChI | InChI=1S/C18H21N5S.HI/c1-19-18(22-13-14-7-4-5-11-20-14)21-12-6-10-17-23-15-8-2-3-9-16(15)24-17;/h2-5,7-9,11H,6,10,12-13H2,1H3,(H2,19,21,22);1H |
| InChIKey | GSZXRKPSQGMMNZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|