C15H21IN4S — CID 110981592
1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110981592) has the molecular formula C15H21IN4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110981592 |
| Molecular Formula | C15H21IN4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCCc1nc2ccccc2s1.I |
| InChI | InChI=1S/C15H20N4S.HI/c1-3-10-17-15(16-2)18-11-6-9-14-19-12-7-4-5-8-13(12)20-14;/h3-5,7-8H,1,6,9-11H2,2H3,(H2,16,17,18);1H |
| InChIKey | DGNAXWOXUDZYLQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|