C18H20F3N5S2 — CID 111687614
1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111687614) has the molecular formula C18H20F3N5S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111687614 |
| Molecular Formula | C18H20F3N5S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H20F3N5S2/c1-22-17(24-10-8-15-26-14(11-27-15)18(19,20)21)23-9-4-7-16-25-12-5-2-3-6-13(12)28-16/h2-3,5-6,11H,4,7-10H2,1H3,(H2,22,23,24) |
| InChIKey | CFSXASVRBHJHCD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|