C22H28N4O2S — CID 111878629
1-[3-(1,3-benzothiazol-2-yl)propyl]-2-[(2,4-dimethoxyphenyl)methyl]-3-ethylguanidine (PubChem CID 111878629) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-[(2,4-dimethoxyphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-[(2,4-dimethoxyphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111878629 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-2-[(2,4-dimethoxyphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H28N4O2S/c1-4-23-22(25-15-16-11-12-17(27-2)14-19(16)28-3)24-13-7-10-21-26-18-8-5-6-9-20(18)29-21/h5-6,8-9,11-12,14H,4,7,10,13,15H2,1-3H3,(H2,23,24,25) |
| InChIKey | SPOWUTRPGFMFQG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|