C21H31IN4O4 — CID 111246098
2-[[N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111246098) has the molecular formula C21H31IN4O4 and a molecular weight of 530.41 g/mol. Its IUPAC name is 2-[[N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111246098 |
| Molecular Formula | C21H31IN4O4 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 2-[[N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCC(=O)NCc2ccco2)cc1OCC.I |
| InChI | InChI=1S/C21H30N4O4.HI/c1-4-27-18-9-8-16(13-19(18)28-5-2)10-11-23-21(22-3)25-15-20(26)24-14-17-7-6-12-29-17;/h6-9,12-13H,4-5,10-11,14-15H2,1-3H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | NAAPTISFGRGWTH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|