C39H42O7 — CID 11124991
(3aS,5R,6R,7S,7aS)-2-pent-4-enoxy-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 11124991) has the molecular formula C39H42O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is (3aS,5R,6R,7S,7aS)-2-pent-4-enoxy-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (3aS,5R,6R,7S,7aS)-2-pent-4-enoxy-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 11124991 |
| Molecular Formula | C39H42O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (3aS,5R,6R,7S,7aS)-2-pent-4-enoxy-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | C=CCCCOC1(c2ccccc2)O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C39H42O7/c1-2-3-16-25-43-39(33-23-14-7-15-24-33)45-37-36(42-28-32-21-12-6-13-22-32)35(41-27-31-19-10-5-11-20-31)34(44-38(37)46-39)29-40-26-30-17-8-4-9-18-30/h2,4-15,17-24,34-38H,1,3,16,25-29H2/t34-,35-,36+,37+,38+,39?/m1/s1 |
| InChIKey | KYOFAUBNXNYOON-XKDRKNCHSA-N |
| XLogP | 7.31 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|