C35H46O8 — CID 10769805
CID 10769805 (PubChem CID 10769805) has the molecular formula C35H46O8 and a molecular weight of 594.75 g/mol.
| Compound Name | CID 10769805 |
|---|---|
| PubChem CID | 10769805 |
| Molecular Formula | C35H46O8 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | — |
| SMILES | C=CCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2O[C@]3(CCCCO3)[C@@]3(CCCCO3)O[C@@H]12 |
| InChI | InChI=1S/C35H46O8/c1-2-3-12-21-37-33-32-31(42-34(19-10-13-22-39-34)35(43-32)20-11-14-23-40-35)30(38-25-28-17-8-5-9-18-28)29(41-33)26-36-24-27-15-6-4-7-16-27/h2,4-9,15-18,29-33H,1,3,10-14,19-26H2/t29-,30-,31+,32-,33-,34-,35-/m1/s1 |
| InChIKey | MICODOVCPFGIKF-VUXXPKCLSA-N |
| XLogP | 6.07 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|