C21H32O3 — CID 167536300
(2R,4S,5S)-3,4,5-trimethyl-2-pent-4-enoxy-6-(phenylmethoxymethyl)oxane (PubChem CID 167536300) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (2R,4S,5S)-3,4,5-trimethyl-2-pent-4-enoxy-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,4S,5S)-3,4,5-trimethyl-2-pent-4-enoxy-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 167536300 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (2R,4S,5S)-3,4,5-trimethyl-2-pent-4-enoxy-6-(phenylmethoxymethyl)oxane |
| SMILES | C=CCCCO[C@@H]1OC(COCc2ccccc2)[C@@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C21H32O3/c1-5-6-10-13-23-21-18(4)16(2)17(3)20(24-21)15-22-14-19-11-8-7-9-12-19/h5,7-9,11-12,16-18,20-21H,1,6,10,13-15H2,2-4H3/t16-,17-,18?,20?,21+/m0/s1 |
| InChIKey | APLAYOSBIIDULX-LEYYPSESSA-N |
| XLogP | 4.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|