C32H58AcO7 — CID 59070828
actinium;[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-pent-4-enoxyoxan-2-yl]methoxy]oxan-2-yl]methoxy]oxan-2-yl]methanol (PubChem CID 59070828) has the molecular formula C32H58AcO7 and a molecular weight of 781.81 g/mol. Its IUPAC name is actinium;[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-pent-4-enoxyoxan-2-yl]methoxy]oxan-2-yl]methoxy]oxan-2-yl]methanol.
| Compound Name | actinium;[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-pent-4-enoxyoxan-2-yl]methoxy]oxan-2-yl]methoxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 59070828 |
| Molecular Formula | C32H58AcO7 |
| Molecular Weight | 781.81 g/mol |
| Exact Mass | 781.45 |
| IUPAC Name | actinium;[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-[[(3R,4S,6R)-3,4,5-trimethyl-6-pent-4-enoxyoxan-2-yl]methoxy]oxan-2-yl]methoxy]oxan-2-yl]methanol |
| SMILES | C=CCCCO[C@@H]1OC(CO[C@@H]2OC(CO[C@@H]3OC(CO)[C@H](C)[C@H](C)C3C)[C@H](C)[C@H](C)C2C)[C@H](C)[C@H](C)C1C.[Ac] |
| InChI | InChI=1S/C32H58O7.Ac/c1-11-12-13-14-34-30-24(8)19(3)22(6)28(38-30)16-36-32-26(10)20(4)23(7)29(39-32)17-35-31-25(9)18(2)21(5)27(15-33)37-31;/h11,18-33H,1,12-17H2,2-10H3;/t18-,19-,20-,21+,22+,23+,24?,25?,26?,27?,28?,29?,30+,31+,32+;/m0./s1 |
| InChIKey | RVHASPPBUMGYSI-SYDFUSPASA-N |
| XLogP | 5.89 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|