C28H38O8 — CID 10815316
CID 10815316 (PubChem CID 10815316) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol.
| Compound Name | CID 10815316 |
|---|---|
| PubChem CID | 10815316 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | — |
| SMILES | C=CCCCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]2O[C@]3(CCCCO3)[C@@]3(CCCCO3)O[C@@H]12 |
| InChI | InChI=1S/C28H38O8/c1-2-3-9-16-29-26-24-23(22-21(33-26)19-30-25(34-22)20-12-5-4-6-13-20)35-27(14-7-10-17-31-27)28(36-24)15-8-11-18-32-28/h2,4-6,12-13,21-26H,1,3,7-11,14-19H2/t21-,22-,23+,24-,25?,26-,27-,28-/m1/s1 |
| InChIKey | ZSHNRNDBWFABCD-HWCWZXDUSA-N |
| XLogP | 4.39 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|