C17H28N4O2S — CID 111252491
methyl 1-[N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252491) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is methyl 1-[N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252491 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | methyl 1-[N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCc1csc(C(C)(C)C)n1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H28N4O2S/c1-17(2,3)15-20-13(11-24-15)10-19-16(18-4)21-8-6-12(7-9-21)14(22)23-5/h11-12H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | BXHOVQKMOLWGFW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|