C24H26N6S — CID 111259747
1-ethyl-3-(thiophen-2-ylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine (PubChem CID 111259747) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is 1-ethyl-3-(thiophen-2-ylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(thiophen-2-ylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111259747 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-ethyl-3-(thiophen-2-ylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1-c1ccc(Cn2cncn2)cc1)NCc1cccs1 |
| InChI | InChI=1S/C24H26N6S/c1-2-26-24(28-15-22-7-5-13-31-22)27-14-21-6-3-4-8-23(21)20-11-9-19(10-12-20)16-30-18-25-17-29-30/h3-13,17-18H,2,14-16H2,1H3,(H2,26,27,28) |
| InChIKey | KYTQNSFMFFLBSN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|