C21H27IN6 — CID 111081513
1-butyl-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111081513) has the molecular formula C21H27IN6 and a molecular weight of 490.39 g/mol. Its IUPAC name is 1-butyl-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081513 |
| Molecular Formula | C21H27IN6 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 1-butyl-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccccc1-c1ccc(Cn2cncn2)cc1.I |
| InChI | InChI=1S/C21H26N6.HI/c1-2-3-12-24-21(22)25-13-19-6-4-5-7-20(19)18-10-8-17(9-11-18)14-27-16-23-15-26-27;/h4-11,15-16H,2-3,12-14H2,1H3,(H3,22,24,25);1H |
| InChIKey | RDDKBNCQBVWKFK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|