C22H26N6 — CID 111081550
1-(cyclobutylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine (PubChem CID 111081550) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111081550 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1-c1ccc(Cn2cncn2)cc1)NCC1CCC1 |
| InChI | InChI=1S/C22H26N6/c23-22(25-12-17-4-3-5-17)26-13-20-6-1-2-7-21(20)19-10-8-18(9-11-19)14-28-16-24-15-27-28/h1-2,6-11,15-17H,3-5,12-14H2,(H3,23,25,26) |
| InChIKey | JQZVMGPFBWPMOE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|