C24H26IN7 — CID 111081543
1-(2-pyridin-2-ylethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111081543) has the molecular formula C24H26IN7 and a molecular weight of 539.43 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-pyridin-2-ylethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081543 |
| Molecular Formula | C24H26IN7 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1-c1ccc(Cn2cncn2)cc1)NCCc1ccccn1 |
| InChI | InChI=1S/C24H25N7.HI/c25-24(28-14-12-22-6-3-4-13-27-22)29-15-21-5-1-2-7-23(21)20-10-8-19(9-11-20)16-31-18-26-17-30-31;/h1-11,13,17-18H,12,14-16H2,(H3,25,28,29);1H |
| InChIKey | BSYTVHOIPFMYQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|