C25H27IN6O2 — CID 111081545
1-(2,5-dimethoxyphenyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111081545) has the molecular formula C25H27IN6O2 and a molecular weight of 570.44 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081545 |
| Molecular Formula | C25H27IN6O2 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[[2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2ccccc2-c2ccc(Cn3cncn3)cc2)c1.I |
| InChI | InChI=1S/C25H26N6O2.HI/c1-32-21-11-12-24(33-2)23(13-21)30-25(26)28-14-20-5-3-4-6-22(20)19-9-7-18(8-10-19)15-31-17-27-16-29-31;/h3-13,16-17H,14-15H2,1-2H3,(H3,26,28,30);1H |
| InChIKey | WKIIBVAFZAZBIK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|