C25H24ClN5O — CID 111090791
1-(3-chloro-4-methoxyphenyl)-2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine (PubChem CID 111090791) has the molecular formula C25H24ClN5O and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111090791 |
| Molecular Formula | C25H24ClN5O |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccccc2-c2ccc(Cn3ccnc3)cc2)cc1Cl |
| InChI | InChI=1S/C25H24ClN5O/c1-32-24-11-10-21(14-23(24)26)30-25(27)29-15-20-4-2-3-5-22(20)19-8-6-18(7-9-19)16-31-13-12-28-17-31/h2-14,17H,15-16H2,1H3,(H3,27,29,30) |
| InChIKey | DDIDQYGUFBGLRO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|