C25H26IN5O — CID 111090732
2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-(2-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111090732) has the molecular formula C25H26IN5O and a molecular weight of 539.42 g/mol. Its IUPAC name is 2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-(2-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111090732 |
| Molecular Formula | C25H26IN5O |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 2-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/Cc1ccccc1-c1ccc(Cn2ccnc2)cc1.I |
| InChI | InChI=1S/C25H25N5O.HI/c1-31-24-9-5-4-8-23(24)29-25(26)28-16-21-6-2-3-7-22(21)20-12-10-19(11-13-20)17-30-15-14-27-18-30;/h2-15,18H,16-17H2,1H3,(H3,26,28,29);1H |
| InChIKey | CUHVQSLEUPTBMY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|