C6H7N — CID 11126181
(1S,4R)-2-azabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 11126181) has the molecular formula C6H7N and a molecular weight of 93.13 g/mol. Its IUPAC name is (1S,4R)-2-azabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1S,4R)-2-azabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 11126181 |
| Molecular Formula | C6H7N |
| Molecular Weight | 93.13 g/mol |
| Exact Mass | 93.06 |
| IUPAC Name | (1S,4R)-2-azabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C1=C[C@@H]2C[C@H]1C=N2 |
| InChI | InChI=1S/C6H7N/c1-2-6-3-5(1)4-7-6/h1-2,4-6H,3H2/t5-,6+/m0/s1 |
| InChIKey | BIXPJRFRJANWRK-NTSWFWBYSA-N |
| XLogP | 1.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 93.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|