C8H11N — CID 90988248
3a,4,5,7a-tetrahydro-3H-indole (PubChem CID 90988248) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-3H-indole.
| Compound Name | 3a,4,5,7a-tetrahydro-3H-indole |
|---|---|
| PubChem CID | 90988248 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-3H-indole |
| SMILES | C1=CC2N=CCC2CC1 |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h2,4,6-8H,1,3,5H2 |
| InChIKey | YTXYHQMVEMGLBC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|