C6H7NO2 — CID 11126259
(3aS,6aR)-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-2-one (PubChem CID 11126259) has the molecular formula C6H7NO2 and a molecular weight of 125.13 g/mol. Its IUPAC name is (3aS,6aR)-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 11126259 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | (3aS,6aR)-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-2-one |
| SMILES | O=C1N[C@H]2CC=C[C@H]2O1 |
| InChI | InChI=1S/C6H7NO2/c8-6-7-4-2-1-3-5(4)9-6/h1,3-5H,2H2,(H,7,8)/t4-,5+/m0/s1 |
| InChIKey | DEJBTPRNZVSSNS-CRCLSJGQSA-N |
| XLogP | 0.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|