C7H11NO2 — CID 13395611
4-methyl-5-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 13395611) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-methyl-5-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-5-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 13395611 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 4-methyl-5-[(E)-prop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/C1OC(=O)NC1C |
| InChI | InChI=1S/C7H11NO2/c1-3-4-6-5(2)8-7(9)10-6/h3-6H,1-2H3,(H,8,9)/b4-3+ |
| InChIKey | CZSGRATYTPYMPP-ONEGZZNKSA-N |
| XLogP | 1.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|