C25H34IN5O — CID 111263426
2-(dimethylamino)-N-[3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111263426) has the molecular formula C25H34IN5O and a molecular weight of 547.49 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111263426 |
| Molecular Formula | C25H34IN5O |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CN(C)C)c1)N1CC=C(c2ccccc2)CC1.I |
| InChI | InChI=1S/C25H33N5O.HI/c1-4-26-25(30-15-13-22(14-16-30)21-10-6-5-7-11-21)27-18-20-9-8-12-23(17-20)28-24(31)19-29(2)3;/h5-13,17H,4,14-16,18-19H2,1-3H3,(H,26,27)(H,28,31);1H |
| InChIKey | HCFBKMIPOBJAQL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|