C9H20ClN — CID 11126820
(2R,6S)-2-methyl-6-propylpiperidin-1-ium chloride (PubChem CID 11126820) has the molecular formula C9H20ClN and a molecular weight of 177.72 g/mol. Its IUPAC name is (2R,6S)-2-methyl-6-propylpiperidin-1-ium chloride.
| Compound Name | (2R,6S)-2-methyl-6-propylpiperidin-1-ium chloride |
|---|---|
| PubChem CID | 11126820 |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2R,6S)-2-methyl-6-propylpiperidin-1-ium chloride |
| SMILES | CCC[C@H]1CCC[C@@H](C)[NH2+]1.[Cl-] |
| InChI | InChI=1S/C9H19N.ClH/c1-3-5-9-7-4-6-8(2)10-9;/h8-10H,3-7H2,1-2H3;1H/t8-,9+;/m1./s1 |
| InChIKey | SXROKZGSWIUYCJ-RJUBDTSPSA-N |
| XLogP | -1.71 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |