C7H16N+ — CID 6560360
(2S,6S)-2,6-dimethylpiperidin-1-ium (PubChem CID 6560360) has the molecular formula C7H16N+ and a molecular weight of 114.21 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethylpiperidin-1-ium.
| Compound Name | (2S,6S)-2,6-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 6560360 |
| Molecular Formula | C7H16N+ |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.13 |
| IUPAC Name | (2S,6S)-2,6-dimethylpiperidin-1-ium |
| SMILES | C[C@H]1CCC[C@H](C)[NH2+]1 |
| InChI | InChI=1S/C7H15N/c1-6-4-3-5-7(2)8-6/h6-8H,3-5H2,1-2H3/p+1/t6-,7-/m0/s1 |
| InChIKey | SDGKUVSVPIIUCF-BQBZGAKWSA-O |
| XLogP | 0.51 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |