C6H16N2+2 — CID 6950260
(2S,6R)-2,6-dimethylpiperazine-1,4-diium (PubChem CID 6950260) has the molecular formula C6H16N2+2 and a molecular weight of 116.21 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylpiperazine-1,4-diium.
| Compound Name | (2S,6R)-2,6-dimethylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 6950260 |
| Molecular Formula | C6H16N2+2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | (2S,6R)-2,6-dimethylpiperazine-1,4-diium |
| SMILES | C[C@@H]1C[NH2+]C[C@H](C)[NH2+]1 |
| InChI | InChI=1S/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3/p+2/t5-,6+ |
| InChIKey | IFNWESYYDINUHV-OLQVQODUSA-P |
| XLogP | -2.10 |
| TPSA | 33.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |