C22H30IN5O3 — CID 111268810
N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111268810) has the molecular formula C22H30IN5O3 and a molecular weight of 539.42 g/mol. Its IUPAC name is N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111268810 |
| Molecular Formula | C22H30IN5O3 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccnc1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C22H29N5O3.HI/c1-4-24-22(26-10-9-25-21(28)17-6-5-8-23-14-17)27-11-7-16-12-19(29-2)20(30-3)13-18(16)15-27;/h5-6,8,12-14H,4,7,9-11,15H2,1-3H3,(H,24,26)(H,25,28);1H |
| InChIKey | MFCAWCADXFEFDA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|