C24H32FIN4O3 — CID 111269906
N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111269906) has the molecular formula C24H32FIN4O3 and a molecular weight of 570.45 g/mol. Its IUPAC name is N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111269906 |
| Molecular Formula | C24H32FIN4O3 |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | N-[2-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)Cc1cccc(F)c1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C24H31FN4O3.HI/c1-4-26-24(28-10-9-27-23(30)13-17-6-5-7-20(25)12-17)29-11-8-18-14-21(31-2)22(32-3)15-19(18)16-29;/h5-7,12,14-15H,4,8-11,13,16H2,1-3H3,(H,26,28)(H,27,30);1H |
| InChIKey | ZRHNYOCNPVLKIT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|