C13H20O3 — CID 11127947
(1R,5R,7R)-5-[2-(methoxymethoxy)ethyl]-7-methylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 11127947) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,5R,7R)-5-[2-(methoxymethoxy)ethyl]-7-methylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5R,7R)-5-[2-(methoxymethoxy)ethyl]-7-methylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 11127947 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1R,5R,7R)-5-[2-(methoxymethoxy)ethyl]-7-methylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | COCOCC[C@]12C=CC(=O)[C@H](C1)[C@H](C)C2 |
| InChI | InChI=1S/C13H20O3/c1-10-7-13(5-6-16-9-15-2)4-3-12(14)11(10)8-13/h3-4,10-11H,5-9H2,1-2H3/t10-,11-,13+/m1/s1 |
| InChIKey | XRPILMSFHMTQBF-WZRBSPASSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|