C14H22O4 — CID 547949
1-(2-methoxyethoxymethoxy)-7a-methyl-2,3,3a,4-tetrahydro-1H-inden-5-one (PubChem CID 547949) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethoxy)-7a-methyl-2,3,3a,4-tetrahydro-1H-inden-5-one.
| Compound Name | 1-(2-methoxyethoxymethoxy)-7a-methyl-2,3,3a,4-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 547949 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(2-methoxyethoxymethoxy)-7a-methyl-2,3,3a,4-tetrahydro-1H-inden-5-one |
| SMILES | COCCOCOC1CCC2CC(=O)C=CC21C |
| InChI | InChI=1S/C14H22O4/c1-14-6-5-12(15)9-11(14)3-4-13(14)18-10-17-8-7-16-2/h5-6,11,13H,3-4,7-10H2,1-2H3 |
| InChIKey | ZINCOUZDDGLQRY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|