C22H35IN6O — CID 111280754
3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide (PubChem CID 111280754) has the molecular formula C22H35IN6O and a molecular weight of 526.47 g/mol. Its IUPAC name is 3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide.
| Compound Name | 3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111280754 |
| Molecular Formula | C22H35IN6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
| SMILES | CCCNC(=O)c1cccc(C/N=C(\NCC)NCCCn2nc(C)cc2C)c1.I |
| InChI | InChI=1S/C22H34N6O.HI/c1-5-11-24-21(29)20-10-7-9-19(15-20)16-26-22(23-6-2)25-12-8-13-28-18(4)14-17(3)27-28;/h7,9-10,14-15H,5-6,8,11-13,16H2,1-4H3,(H,24,29)(H2,23,25,26);1H |
| InChIKey | AJEHIJYWXHLYPC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|