C23H37IN6O — CID 111279348
N-butan-2-yl-3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111279348) has the molecular formula C23H37IN6O and a molecular weight of 540.49 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111279348 |
| Molecular Formula | C23H37IN6O |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N-butan-2-yl-3-[[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C23H36N6O.HI/c1-6-17(3)27-22(30)21-11-8-10-20(15-21)16-26-23(24-7-2)25-12-9-13-29-19(5)14-18(4)28-29;/h8,10-11,14-15,17H,6-7,9,12-13,16H2,1-5H3,(H,27,30)(H2,24,25,26);1H |
| InChIKey | TVQOOUKSNXCBLO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|