C22H27N5O — CID 111282347
3-[(1-benzylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111282347) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-[(1-benzylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[(1-benzylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111282347 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 3-[(1-benzylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1cnn(Cc2ccccc2)c1)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C22H27N5O/c1-23-22(26(2)17-20-11-7-8-12-21(20)28-3)24-13-19-14-25-27(16-19)15-18-9-5-4-6-10-18/h4-12,14,16H,13,15,17H2,1-3H3,(H,23,24) |
| InChIKey | WOLIFGQCYKQALJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|