C23H33N5O2S — CID 111283919
1-[(6-cyclopentyloxy-3-pyridinyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283919) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-[(6-cyclopentyloxy-3-pyridinyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(6-cyclopentyloxy-3-pyridinyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283919 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-[(6-cyclopentyloxy-3-pyridinyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(OC2CCCC2)nc1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C23H33N5O2S/c1-24-23(26-16-18-8-9-22(25-15-18)30-19-5-2-3-6-19)27-17-20(21-7-4-14-31-21)28-10-12-29-13-11-28/h4,7-9,14-15,19-20H,2-3,5-6,10-13,16-17H2,1H3,(H2,24,26,27) |
| InChIKey | PTZIACJZLGFZDH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|