C13H21NO4 — CID 11128903
methyl 2-[(3R,7aR)-3-tert-butyl-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]acetate (PubChem CID 11128903) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is methyl 2-[(3R,7aR)-3-tert-butyl-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]acetate.
| Compound Name | methyl 2-[(3R,7aR)-3-tert-butyl-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]acetate |
|---|---|
| PubChem CID | 11128903 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | methyl 2-[(3R,7aR)-3-tert-butyl-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]acetate |
| SMILES | COC(=O)C[C@@]12CCCN1[C@@H](C(C)(C)C)OC2=O |
| InChI | InChI=1S/C13H21NO4/c1-12(2,3)10-14-7-5-6-13(14,11(16)18-10)8-9(15)17-4/h10H,5-8H2,1-4H3/t10-,13-/m1/s1 |
| InChIKey | MXLVOVSOIYWQOT-ZWNOBZJWSA-N |
| XLogP | 1.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |