C9H15NO2 — CID 58405757
(3R,7aS)-7a-(1,1-dideuterioethyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 58405757) has the molecular formula C9H15NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3R,7aS)-7a-(1,1-dideuterioethyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,7aS)-7a-(1,1-dideuterioethyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 58405757 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | (3R,7aS)-7a-(1,1-dideuterioethyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | [2H]C([2H])(C)[C@@]12CCCN1[C@@H](C)OC2=O |
| InChI | InChI=1S/C9H15NO2/c1-3-9-5-4-6-10(9)7(2)12-8(9)11/h7H,3-6H2,1-2H3/t7-,9+/m1/s1/i3D2 |
| InChIKey | WBCDYKSJUGXPNP-QFVIMHGBSA-N |
| XLogP | 1.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |