C22H33IN6 — CID 111289698
1,2-dimethyl-1-[(4-methylphenyl)methyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111289698) has the molecular formula C22H33IN6 and a molecular weight of 508.45 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-methylphenyl)methyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(4-methylphenyl)methyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111289698 |
| Molecular Formula | C22H33IN6 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 1,2-dimethyl-1-[(4-methylphenyl)methyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCN(C)CC2)nc1)N(C)Cc1ccc(C)cc1.I |
| InChI | InChI=1S/C22H32N6.HI/c1-18-5-7-19(8-6-18)17-27(4)22(23-2)25-16-20-9-10-21(24-15-20)28-13-11-26(3)12-14-28;/h5-10,15H,11-14,16-17H2,1-4H3,(H,23,25);1H |
| InChIKey | ICQLUVKIIOYBEC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|