C23H35N5OS — CID 111291347
1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111291347) has the molecular formula C23H35N5OS and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111291347 |
| Molecular Formula | C23H35N5OS |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C(C)C)n1)NCC(c1ccc(OC)cc1)N1CCCC1 |
| InChI | InChI=1S/C23H35N5OS/c1-17(2)22-27-19(16-30-22)11-12-25-23(24-3)26-15-21(28-13-5-6-14-28)18-7-9-20(29-4)10-8-18/h7-10,16-17,21H,5-6,11-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | ONJSHQNPZHODRC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|