C16H11NO3 — CID 11129204
1,3-benzodioxol-5-yl(indol-1-yl)methanone (PubChem CID 11129204) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(indol-1-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl(indol-1-yl)methanone |
|---|---|
| PubChem CID | 11129204 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl(indol-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)n1ccc2ccccc21 |
| InChI | InChI=1S/C16H11NO3/c18-16(12-5-6-14-15(9-12)20-10-19-14)17-8-7-11-3-1-2-4-13(11)17/h1-9H,10H2 |
| InChIKey | NGEUOVBTYRBHQT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |